C16H24N2O4S — CID 165075706
tert-butyl N-[(3R)-1-(3-methylphenyl)pyrrolidin-3-yl]carbamate;sulfur dioxide (PubChem CID 165075706) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-(3-methylphenyl)pyrrolidin-3-yl]carbamate;sulfur dioxide.
| Compound Name | tert-butyl N-[(3R)-1-(3-methylphenyl)pyrrolidin-3-yl]carbamate;sulfur dioxide |
|---|---|
| PubChem CID | 165075706 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | tert-butyl N-[(3R)-1-(3-methylphenyl)pyrrolidin-3-yl]carbamate;sulfur dioxide |
| SMILES | Cc1cccc(N2CC[C@@H](NC(=O)OC(C)(C)C)C2)c1.O=S=O |
| InChI | InChI=1S/C16H24N2O2.O2S/c1-12-6-5-7-14(10-12)18-9-8-13(11-18)17-15(19)20-16(2,3)4;1-3-2/h5-7,10,13H,8-9,11H2,1-4H3,(H,17,19);/t13-;/m1./s1 |
| InChIKey | UGOZFXVEQBPCNW-BTQNPOSSSA-N |
| XLogP | 2.43 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |