C22H38N4O2S — CID 170639251
tert-butyl N-[1-(3-piperazin-1-ylphenyl)sulfanylpiperidin-4-yl]carbamate;ethane (PubChem CID 170639251) has the molecular formula C22H38N4O2S and a molecular weight of 422.64 g/mol. Its IUPAC name is tert-butyl N-[1-(3-piperazin-1-ylphenyl)sulfanylpiperidin-4-yl]carbamate;ethane.
| Compound Name | tert-butyl N-[1-(3-piperazin-1-ylphenyl)sulfanylpiperidin-4-yl]carbamate;ethane |
|---|---|
| PubChem CID | 170639251 |
| Molecular Formula | C22H38N4O2S |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | tert-butyl N-[1-(3-piperazin-1-ylphenyl)sulfanylpiperidin-4-yl]carbamate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)NC1CCN(Sc2cccc(N3CCNCC3)c2)CC1 |
| InChI | InChI=1S/C20H32N4O2S.C2H6/c1-20(2,3)26-19(25)22-16-7-11-24(12-8-16)27-18-6-4-5-17(15-18)23-13-9-21-10-14-23;1-2/h4-6,15-16,21H,7-14H2,1-3H3,(H,22,25);1-2H3 |
| InChIKey | FRLSMHIFEQZBCO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|