C36H47N7O5S — CID 164557340
tert-butyl N-[1-[3-[4-[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]azetidin-3-yl]piperazin-1-yl]phenyl]sulfanylpiperidin-4-yl]carbamate (PubChem CID 164557340) has the molecular formula C36H47N7O5S and a molecular weight of 689.88 g/mol. Its IUPAC name is tert-butyl N-[1-[3-[4-[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]azetidin-3-yl]piperazin-1-yl]phenyl]sulfanylpiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-[4-[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]azetidin-3-yl]piperazin-1-yl]phenyl]sulfanylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 164557340 |
| Molecular Formula | C36H47N7O5S |
| Molecular Weight | 689.88 g/mol |
| Exact Mass | 689.34 |
| IUPAC Name | tert-butyl N-[1-[3-[4-[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]azetidin-3-yl]piperazin-1-yl]phenyl]sulfanylpiperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(Sc2cccc(N3CCN(C4CN(c5ccc6c(c5)CN(C5CCC(=O)NC5=O)C6=O)C4)CC3)c2)CC1 |
| InChI | InChI=1S/C36H47N7O5S/c1-36(2,3)48-35(47)37-25-11-13-42(14-12-25)49-29-6-4-5-26(20-29)39-15-17-40(18-16-39)28-22-41(23-28)27-7-8-30-24(19-27)21-43(34(30)46)31-9-10-32(44)38-33(31)45/h4-8,19-20,25,28,31H,9-18,21-23H2,1-3H3,(H,37,47)(H,38,44,45) |
| InChIKey | YHDOFBRULFAODI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.88 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|