C37H48N6O5S — CID 170639065
tert-butyl N-[1-[3-[[7-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-2,7-diazaspiro[3.5]nonan-2-yl]methyl]phenyl]sulfanylpiperidin-4-yl]carbamate (PubChem CID 170639065) has the molecular formula C37H48N6O5S and a molecular weight of 688.89 g/mol. Its IUPAC name is tert-butyl N-[1-[3-[[7-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-2,7-diazaspiro[3.5]nonan-2-yl]methyl]phenyl]sulfanylpiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-[[7-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-2,7-diazaspiro[3.5]nonan-2-yl]methyl]phenyl]sulfanylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 170639065 |
| Molecular Formula | C37H48N6O5S |
| Molecular Weight | 688.89 g/mol |
| Exact Mass | 688.34 |
| IUPAC Name | tert-butyl N-[1-[3-[[7-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-2,7-diazaspiro[3.5]nonan-2-yl]methyl]phenyl]sulfanylpiperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(Sc2cccc(CN3CC4(CCN(c5ccc6c(c5)CN(C5CCC(=O)NC5=O)C6=O)CC4)C3)c2)CC1 |
| InChI | InChI=1S/C37H48N6O5S/c1-36(2,3)48-35(47)38-27-11-15-42(16-12-27)49-29-6-4-5-25(19-29)21-40-23-37(24-40)13-17-41(18-14-37)28-7-8-30-26(20-28)22-43(34(30)46)31-9-10-32(44)39-33(31)45/h4-8,19-20,27,31H,9-18,21-24H2,1-3H3,(H,38,47)(H,39,44,45) |
| InChIKey | OAZYNCQUCYRSCA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.89 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|