C34H41FN6O6S — CID 170639278
tert-butyl N-[1-[3-[[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]piperazin-1-yl]methyl]phenyl]sulfanylpiperidin-4-yl]carbamate (PubChem CID 170639278) has the molecular formula C34H41FN6O6S and a molecular weight of 680.80 g/mol. Its IUPAC name is tert-butyl N-[1-[3-[[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]piperazin-1-yl]methyl]phenyl]sulfanylpiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-[[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]piperazin-1-yl]methyl]phenyl]sulfanylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 170639278 |
| Molecular Formula | C34H41FN6O6S |
| Molecular Weight | 680.80 g/mol |
| Exact Mass | 680.28 |
| IUPAC Name | tert-butyl N-[1-[3-[[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]piperazin-1-yl]methyl]phenyl]sulfanylpiperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(Sc2cccc(CN3CCN(c4cc5c(cc4F)C(=O)N(C4CCC(=O)NC4=O)C5=O)CC3)c2)CC1 |
| InChI | InChI=1S/C34H41FN6O6S/c1-34(2,3)47-33(46)36-22-9-11-40(12-10-22)48-23-6-4-5-21(17-23)20-38-13-15-39(16-14-38)28-19-25-24(18-26(28)35)31(44)41(32(25)45)27-7-8-29(42)37-30(27)43/h4-6,17-19,22,27H,7-16,20H2,1-3H3,(H,36,46)(H,37,42,43) |
| InChIKey | QHPYEDLVAYBCEO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 131.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.80 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|