C19H26N2O3S2 — CID 176668367
tert-butyl N-[1-[(7-methoxy-1-benzothiophen-3-yl)sulfanyl]piperidin-4-yl]carbamate (PubChem CID 176668367) has the molecular formula C19H26N2O3S2 and a molecular weight of 394.56 g/mol. Its IUPAC name is tert-butyl N-[1-[(7-methoxy-1-benzothiophen-3-yl)sulfanyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(7-methoxy-1-benzothiophen-3-yl)sulfanyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 176668367 |
| Molecular Formula | C19H26N2O3S2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | tert-butyl N-[1-[(7-methoxy-1-benzothiophen-3-yl)sulfanyl]piperidin-4-yl]carbamate |
| SMILES | COc1cccc2c(SN3CCC(NC(=O)OC(C)(C)C)CC3)csc12 |
| InChI | InChI=1S/C19H26N2O3S2/c1-19(2,3)24-18(22)20-13-8-10-21(11-9-13)26-16-12-25-17-14(16)6-5-7-15(17)23-4/h5-7,12-13H,8-11H2,1-4H3,(H,20,22) |
| InChIKey | WFRFKFXANKAYLB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|