C18H23BrN2O4S2 — CID 176668194
tert-butyl N-[1-[(7-bromo-1-benzothiophen-3-yl)sulfonyl]piperidin-4-yl]carbamate (PubChem CID 176668194) has the molecular formula C18H23BrN2O4S2 and a molecular weight of 475.43 g/mol. Its IUPAC name is tert-butyl N-[1-[(7-bromo-1-benzothiophen-3-yl)sulfonyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(7-bromo-1-benzothiophen-3-yl)sulfonyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 176668194 |
| Molecular Formula | C18H23BrN2O4S2 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | tert-butyl N-[1-[(7-bromo-1-benzothiophen-3-yl)sulfonyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(S(=O)(=O)c2csc3c(Br)cccc23)CC1 |
| InChI | InChI=1S/C18H23BrN2O4S2/c1-18(2,3)25-17(22)20-12-7-9-21(10-8-12)27(23,24)15-11-26-16-13(15)5-4-6-14(16)19/h4-6,11-12H,7-10H2,1-3H3,(H,20,22) |
| InChIKey | GZWFALRCJZAPCK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |