C19H26BrN3O4S — CID 176668297
tert-butyl N-[1-(7-bromo-1-methylindol-3-yl)sulfonylpiperidin-4-yl]carbamate (PubChem CID 176668297) has the molecular formula C19H26BrN3O4S and a molecular weight of 472.41 g/mol. Its IUPAC name is tert-butyl N-[1-(7-bromo-1-methylindol-3-yl)sulfonylpiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(7-bromo-1-methylindol-3-yl)sulfonylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 176668297 |
| Molecular Formula | C19H26BrN3O4S |
| Molecular Weight | 472.41 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | tert-butyl N-[1-(7-bromo-1-methylindol-3-yl)sulfonylpiperidin-4-yl]carbamate |
| SMILES | Cn1cc(S(=O)(=O)N2CCC(NC(=O)OC(C)(C)C)CC2)c2cccc(Br)c21 |
| InChI | InChI=1S/C19H26BrN3O4S/c1-19(2,3)27-18(24)21-13-8-10-23(11-9-13)28(25,26)16-12-22(4)17-14(16)6-5-7-15(17)20/h5-7,12-13H,8-11H2,1-4H3,(H,21,24) |
| InChIKey | CDLKFNJVAVYNPF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |