C18H23N3O4S — CID 176668321
N-[1-(7-methoxy-1-methylindol-3-yl)sulfonylpiperidin-4-yl]prop-2-enamide (PubChem CID 176668321) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is N-[1-(7-methoxy-1-methylindol-3-yl)sulfonylpiperidin-4-yl]prop-2-enamide.
| Compound Name | N-[1-(7-methoxy-1-methylindol-3-yl)sulfonylpiperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 176668321 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-[1-(7-methoxy-1-methylindol-3-yl)sulfonylpiperidin-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCN(S(=O)(=O)c2cn(C)c3c(OC)cccc23)CC1 |
| InChI | InChI=1S/C18H23N3O4S/c1-4-17(22)19-13-8-10-21(11-9-13)26(23,24)16-12-20(2)18-14(16)6-5-7-15(18)25-3/h4-7,12-13H,1,8-11H2,2-3H3,(H,19,22) |
| InChIKey | JKRNWHMECVBHRY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|