C20H26N2O5 — CID 70197899
tert-butyl N-[1-(4-methoxy-1-benzofuran-3-carbonyl)piperidin-4-yl]carbamate (PubChem CID 70197899) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is tert-butyl N-[1-(4-methoxy-1-benzofuran-3-carbonyl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(4-methoxy-1-benzofuran-3-carbonyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 70197899 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | tert-butyl N-[1-(4-methoxy-1-benzofuran-3-carbonyl)piperidin-4-yl]carbamate |
| SMILES | COc1cccc2occ(C(=O)N3CCC(NC(=O)OC(C)(C)C)CC3)c12 |
| InChI | InChI=1S/C20H26N2O5/c1-20(2,3)27-19(24)21-13-8-10-22(11-9-13)18(23)14-12-26-16-7-5-6-15(25-4)17(14)16/h5-7,12-13H,8-11H2,1-4H3,(H,21,24) |
| InChIKey | KVCXSAPEPMSWPO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |