C20H33N3O3 — CID 58006150
tert-butyl N-[1-[[2-(dimethylamino)-6-methoxyphenyl]methyl]piperidin-4-yl]carbamate (PubChem CID 58006150) has the molecular formula C20H33N3O3 and a molecular weight of 363.50 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(dimethylamino)-6-methoxyphenyl]methyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(dimethylamino)-6-methoxyphenyl]methyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 58006150 |
| Molecular Formula | C20H33N3O3 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | tert-butyl N-[1-[[2-(dimethylamino)-6-methoxyphenyl]methyl]piperidin-4-yl]carbamate |
| SMILES | COc1cccc(N(C)C)c1CN1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H33N3O3/c1-20(2,3)26-19(24)21-15-10-12-23(13-11-15)14-16-17(22(4)5)8-7-9-18(16)25-6/h7-9,15H,10-14H2,1-6H3,(H,21,24) |
| InChIKey | ZHZYIFHUZNJVMK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |