C23H30N2O6 — CID 55870043
tert-butyl N-[1-[5-[(2-methoxyphenoxy)methyl]furan-2-carbonyl]piperidin-4-yl]carbamate (PubChem CID 55870043) has the molecular formula C23H30N2O6 and a molecular weight of 430.50 g/mol. Its IUPAC name is tert-butyl N-[1-[5-[(2-methoxyphenoxy)methyl]furan-2-carbonyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[5-[(2-methoxyphenoxy)methyl]furan-2-carbonyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 55870043 |
| Molecular Formula | C23H30N2O6 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | tert-butyl N-[1-[5-[(2-methoxyphenoxy)methyl]furan-2-carbonyl]piperidin-4-yl]carbamate |
| SMILES | COc1ccccc1OCc1ccc(C(=O)N2CCC(NC(=O)OC(C)(C)C)CC2)o1 |
| InChI | InChI=1S/C23H30N2O6/c1-23(2,3)31-22(27)24-16-11-13-25(14-12-16)21(26)20-10-9-17(30-20)15-29-19-8-6-5-7-18(19)28-4/h5-10,16H,11-15H2,1-4H3,(H,24,27) |
| InChIKey | HFKOUIROQWCIHZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |