C27H35N3O4 — CID 142598196
tert-butyl N-[1-[4-(5,6-dimethoxy-2-methylindol-1-yl)phenyl]piperidin-4-yl]carbamate (PubChem CID 142598196) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(5,6-dimethoxy-2-methylindol-1-yl)phenyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(5,6-dimethoxy-2-methylindol-1-yl)phenyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 142598196 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | tert-butyl N-[1-[4-(5,6-dimethoxy-2-methylindol-1-yl)phenyl]piperidin-4-yl]carbamate |
| SMILES | COc1cc2cc(C)n(-c3ccc(N4CCC(NC(=O)OC(C)(C)C)CC4)cc3)c2cc1OC |
| InChI | InChI=1S/C27H35N3O4/c1-18-15-19-16-24(32-5)25(33-6)17-23(19)30(18)22-9-7-21(8-10-22)29-13-11-20(12-14-29)28-26(31)34-27(2,3)4/h7-10,15-17,20H,11-14H2,1-6H3,(H,28,31) |
| InChIKey | VKZSXLGCUDGEIE-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|