C19H27N3O3 — CID 113256308
tert-butyl N-[3-[3-(2-oxopyrrolidin-1-yl)anilino]cyclobutyl]carbamate (PubChem CID 113256308) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is tert-butyl N-[3-[3-(2-oxopyrrolidin-1-yl)anilino]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-(2-oxopyrrolidin-1-yl)anilino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 113256308 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | tert-butyl N-[3-[3-(2-oxopyrrolidin-1-yl)anilino]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC(Nc2cccc(N3CCCC3=O)c2)C1 |
| InChI | InChI=1S/C19H27N3O3/c1-19(2,3)25-18(24)21-15-10-14(11-15)20-13-6-4-7-16(12-13)22-9-5-8-17(22)23/h4,6-7,12,14-15,20H,5,8-11H2,1-3H3,(H,21,24) |
| InChIKey | PJXZGCSPQRVQTG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |