C22H22F3N3O2 — CID 163399624
N-[4-[4-cyano-3-(trifluoromethyl)anilino]cyclohexyl]-4-methoxybenzamide (PubChem CID 163399624) has the molecular formula C22H22F3N3O2 and a molecular weight of 417.43 g/mol. Its IUPAC name is N-[4-[4-cyano-3-(trifluoromethyl)anilino]cyclohexyl]-4-methoxybenzamide.
| Compound Name | N-[4-[4-cyano-3-(trifluoromethyl)anilino]cyclohexyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 163399624 |
| Molecular Formula | C22H22F3N3O2 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | N-[4-[4-cyano-3-(trifluoromethyl)anilino]cyclohexyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CCC(Nc3ccc(C#N)c(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C22H22F3N3O2/c1-30-19-10-3-14(4-11-19)21(29)28-17-8-6-16(7-9-17)27-18-5-2-15(13-26)20(12-18)22(23,24)25/h2-5,10-12,16-17,27H,6-9H2,1H3,(H,28,29) |
| InChIKey | BCGSHTUFAVMGFI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |