C25H26F3N5O3 — CID 169195178
N-[4-[4-cyano-3-(trifluoromethyl)phenoxy]cyclohexyl]-2-(4-formylpiperidin-1-yl)pyrimidine-5-carboxamide (PubChem CID 169195178) has the molecular formula C25H26F3N5O3 and a molecular weight of 501.51 g/mol. Its IUPAC name is N-[4-[4-cyano-3-(trifluoromethyl)phenoxy]cyclohexyl]-2-(4-formylpiperidin-1-yl)pyrimidine-5-carboxamide.
| Compound Name | N-[4-[4-cyano-3-(trifluoromethyl)phenoxy]cyclohexyl]-2-(4-formylpiperidin-1-yl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 169195178 |
| Molecular Formula | C25H26F3N5O3 |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | N-[4-[4-cyano-3-(trifluoromethyl)phenoxy]cyclohexyl]-2-(4-formylpiperidin-1-yl)pyrimidine-5-carboxamide |
| SMILES | N#Cc1ccc(OC2CCC(NC(=O)c3cnc(N4CCC(C=O)CC4)nc3)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C25H26F3N5O3/c26-25(27,28)22-11-21(4-1-17(22)12-29)36-20-5-2-19(3-6-20)32-23(35)18-13-30-24(31-14-18)33-9-7-16(15-34)8-10-33/h1,4,11,13-16,19-20H,2-3,5-10H2,(H,32,35) |
| InChIKey | SBFGSDVTGRURFN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|