C19H16F3N3O2 — CID 155219080
4-[1-(pyridine-3-carbonyl)piperidin-4-yl]oxy-2-(trifluoromethyl)benzonitrile (PubChem CID 155219080) has the molecular formula C19H16F3N3O2 and a molecular weight of 375.35 g/mol. Its IUPAC name is 4-[1-(pyridine-3-carbonyl)piperidin-4-yl]oxy-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[1-(pyridine-3-carbonyl)piperidin-4-yl]oxy-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 155219080 |
| Molecular Formula | C19H16F3N3O2 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 4-[1-(pyridine-3-carbonyl)piperidin-4-yl]oxy-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(OC2CCN(C(=O)c3cccnc3)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C19H16F3N3O2/c20-19(21,22)17-10-16(4-3-13(17)11-23)27-15-5-8-25(9-6-15)18(26)14-2-1-7-24-12-14/h1-4,7,10,12,15H,5-6,8-9H2 |
| InChIKey | KIGPIKIOJXMAOH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |