C19H22N2O4 — CID 56796144
[4-(2,6-dimethoxyphenoxy)piperidin-1-yl]-pyridin-3-ylmethanone (PubChem CID 56796144) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is [4-(2,6-dimethoxyphenoxy)piperidin-1-yl]-pyridin-3-ylmethanone.
| Compound Name | [4-(2,6-dimethoxyphenoxy)piperidin-1-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 56796144 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | [4-(2,6-dimethoxyphenoxy)piperidin-1-yl]-pyridin-3-ylmethanone |
| SMILES | COc1cccc(OC)c1OC1CCN(C(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C19H22N2O4/c1-23-16-6-3-7-17(24-2)18(16)25-15-8-11-21(12-9-15)19(22)14-5-4-10-20-13-14/h3-7,10,13,15H,8-9,11-12H2,1-2H3 |
| InChIKey | LPOZBBCHWWVAGO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |