C20H24N2O5 — CID 90565963
(4-pyridin-3-yloxypiperidin-1-yl)-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 90565963) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is (4-pyridin-3-yloxypiperidin-1-yl)-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | (4-pyridin-3-yloxypiperidin-1-yl)-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 90565963 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (4-pyridin-3-yloxypiperidin-1-yl)-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)N2CCC(Oc3cccnc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C20H24N2O5/c1-24-17-11-14(12-18(25-2)19(17)26-3)20(23)22-9-6-15(7-10-22)27-16-5-4-8-21-13-16/h4-5,8,11-13,15H,6-7,9-10H2,1-3H3 |
| InChIKey | APHGRIFEECALPB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |