C12H11F3N2 — CID 11481851
4-(cyclopropylmethylamino)-2-(trifluoromethyl)benzonitrile (PubChem CID 11481851) has the molecular formula C12H11F3N2 and a molecular weight of 240.23 g/mol. Its IUPAC name is 4-(cyclopropylmethylamino)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(cyclopropylmethylamino)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 11481851 |
| Molecular Formula | C12H11F3N2 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 4-(cyclopropylmethylamino)-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(NCC2CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C12H11F3N2/c13-12(14,15)11-5-10(4-3-9(11)6-16)17-7-8-1-2-8/h3-5,8,17H,1-2,7H2 |
| InChIKey | YJTJAAIIWZCRAR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |