C14H15F3N2S — CID 115625277
4-(thian-4-ylmethylamino)-2-(trifluoromethyl)benzonitrile (PubChem CID 115625277) has the molecular formula C14H15F3N2S and a molecular weight of 300.35 g/mol. Its IUPAC name is 4-(thian-4-ylmethylamino)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(thian-4-ylmethylamino)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 115625277 |
| Molecular Formula | C14H15F3N2S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 4-(thian-4-ylmethylamino)-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(NCC2CCSCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H15F3N2S/c15-14(16,17)13-7-12(2-1-11(13)8-18)19-9-10-3-5-20-6-4-10/h1-2,7,10,19H,3-6,9H2 |
| InChIKey | WNCNSSHKPRHSQG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |