C24H22BF3N6S — CID 88850040
CID 88850040 (PubChem CID 88850040) has the molecular formula C24H22BF3N6S and a molecular weight of 494.36 g/mol.
| Compound Name | CID 88850040 |
|---|---|
| PubChem CID | 88850040 |
| Molecular Formula | C24H22BF3N6S |
| Molecular Weight | 494.36 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | — |
| SMILES | [H]/N=C1/N(c2ccc(C#N)c(C(F)(F)F)c2)C(=S)N(c2ccc(N3CCN([B])CC3)cc2)C12CCC2 |
| InChI | InChI=1S/C24H22BF3N6S/c25-32-12-10-31(11-13-32)17-4-6-18(7-5-17)34-22(35)33(21(30)23(34)8-1-9-23)19-3-2-16(15-29)20(14-19)24(26,27)28/h2-7,14,30H,1,8-13H2/b30-21+ |
| InChIKey | NBVURXWCFDUGNT-MWAVMZGNSA-N |
| XLogP | 4.29 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|