C19H16F3N5O2S2 — CID 163606160
4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-4-imino-5,5-dimethyl-2-sulfanylideneimidazolidin-1-yl]benzenesulfonamide (PubChem CID 163606160) has the molecular formula C19H16F3N5O2S2 and a molecular weight of 467.50 g/mol. Its IUPAC name is 4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-4-imino-5,5-dimethyl-2-sulfanylideneimidazolidin-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-4-imino-5,5-dimethyl-2-sulfanylideneimidazolidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 163606160 |
| Molecular Formula | C19H16F3N5O2S2 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | 4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-4-imino-5,5-dimethyl-2-sulfanylideneimidazolidin-1-yl]benzenesulfonamide |
| SMILES | [H]/N=C1/N(c2ccc(C#N)c(C(F)(F)F)c2)C(=S)N(c2ccc(S(N)(=O)=O)cc2)C1(C)C |
| InChI | InChI=1S/C19H16F3N5O2S2/c1-18(2)16(24)26(13-4-3-11(10-23)15(9-13)19(20,21)22)17(30)27(18)12-5-7-14(8-6-12)31(25,28)29/h3-9,24H,1-2H3,(H2,25,28,29)/b24-16+ |
| InChIKey | HBYYPAWZWBNWHM-LFVJCYFKSA-N |
| XLogP | 3.59 |
| TPSA | 114.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|