C30H28F3N3O5S2 — CID 169195015
4-[4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]phenoxy]butyl 4-methylbenzenesulfonate (PubChem CID 169195015) has the molecular formula C30H28F3N3O5S2 and a molecular weight of 631.70 g/mol. Its IUPAC name is 4-[4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]phenoxy]butyl 4-methylbenzenesulfonate.
| Compound Name | 4-[4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]phenoxy]butyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 169195015 |
| Molecular Formula | C30H28F3N3O5S2 |
| Molecular Weight | 631.70 g/mol |
| Exact Mass | 631.14 |
| IUPAC Name | 4-[4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]phenoxy]butyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCOc2ccc(N3C(=S)N(c4ccc(C#N)c(C(F)(F)F)c4)C(=O)C3(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H28F3N3O5S2/c1-20-6-14-25(15-7-20)43(38,39)41-17-5-4-16-40-24-12-10-22(11-13-24)36-28(42)35(27(37)29(36,2)3)23-9-8-21(19-34)26(18-23)30(31,32)33/h6-15,18H,4-5,16-17H2,1-3H3 |
| InChIKey | KDFMIOFEGMKSRA-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 99.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.70 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|