C28H33F3N4O2S — CID 88561323
4-[4,4-dimethyl-5-oxo-3-[3-[4-[(pentan-3-ylamino)methyl]phenoxy]propyl]-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 88561323) has the molecular formula C28H33F3N4O2S and a molecular weight of 546.66 g/mol. Its IUPAC name is 4-[4,4-dimethyl-5-oxo-3-[3-[4-[(pentan-3-ylamino)methyl]phenoxy]propyl]-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4,4-dimethyl-5-oxo-3-[3-[4-[(pentan-3-ylamino)methyl]phenoxy]propyl]-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 88561323 |
| Molecular Formula | C28H33F3N4O2S |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | 4-[4,4-dimethyl-5-oxo-3-[3-[4-[(pentan-3-ylamino)methyl]phenoxy]propyl]-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CCC(CC)NCc1ccc(OCCCN2C(=S)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)C2(C)C)cc1 |
| InChI | InChI=1S/C28H33F3N4O2S/c1-5-21(6-2)33-18-19-8-12-23(13-9-19)37-15-7-14-34-26(38)35(25(36)27(34,3)4)22-11-10-20(17-32)24(16-22)28(29,30)31/h8-13,16,21,33H,5-7,14-15,18H2,1-4H3 |
| InChIKey | QXTWPFZSKCQHLW-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|