C25H27F3N4O4S2 — CID 88561425
4-[3-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]propoxy]-N-propan-2-ylbenzenesulfonamide (PubChem CID 88561425) has the molecular formula C25H27F3N4O4S2 and a molecular weight of 568.64 g/mol. Its IUPAC name is 4-[3-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]propoxy]-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-[3-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]propoxy]-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 88561425 |
| Molecular Formula | C25H27F3N4O4S2 |
| Molecular Weight | 568.64 g/mol |
| Exact Mass | 568.14 |
| IUPAC Name | 4-[3-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]propoxy]-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(OCCCN2C(=S)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)C2(C)C)cc1 |
| InChI | InChI=1S/C25H27F3N4O4S2/c1-16(2)30-38(34,35)20-10-8-19(9-11-20)36-13-5-12-31-23(37)32(22(33)24(31,3)4)18-7-6-17(15-29)21(14-18)25(26,27)28/h6-11,14,16,30H,5,12-13H2,1-4H3 |
| InChIKey | LYZSJMFHKYZYJD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.64 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|