C29H32F3N3O6S — CID 122423208
2-[3-[5-[4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]phenoxy]pentoxy]propoxy]acetic acid (PubChem CID 122423208) has the molecular formula C29H32F3N3O6S and a molecular weight of 607.65 g/mol. Its IUPAC name is 2-[3-[5-[4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]phenoxy]pentoxy]propoxy]acetic acid.
| Compound Name | 2-[3-[5-[4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]phenoxy]pentoxy]propoxy]acetic acid |
|---|---|
| PubChem CID | 122423208 |
| Molecular Formula | C29H32F3N3O6S |
| Molecular Weight | 607.65 g/mol |
| Exact Mass | 607.20 |
| IUPAC Name | 2-[3-[5-[4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]phenoxy]pentoxy]propoxy]acetic acid |
| SMILES | CC1(C)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=S)N1c1ccc(OCCCCCOCCCOCC(=O)O)cc1 |
| InChI | InChI=1S/C29H32F3N3O6S/c1-28(2)26(38)34(22-8-7-20(18-33)24(17-22)29(30,31)32)27(42)35(28)21-9-11-23(12-10-21)41-16-5-3-4-13-39-14-6-15-40-19-25(36)37/h7-12,17H,3-6,13-16,19H2,1-2H3,(H,36,37) |
| InChIKey | OTBJLLIPQREYHC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 112.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.65 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|