C24H22F3N3O6S — CID 145127188
2-[3-[4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]phenyl]peroxypropoxy]acetic acid (PubChem CID 145127188) has the molecular formula C24H22F3N3O6S and a molecular weight of 537.52 g/mol. Its IUPAC name is 2-[3-[4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]phenyl]peroxypropoxy]acetic acid.
| Compound Name | 2-[3-[4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]phenyl]peroxypropoxy]acetic acid |
|---|---|
| PubChem CID | 145127188 |
| Molecular Formula | C24H22F3N3O6S |
| Molecular Weight | 537.52 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | 2-[3-[4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]phenyl]peroxypropoxy]acetic acid |
| SMILES | CC1(C)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=S)N1c1ccc(OOCCCOCC(=O)O)cc1 |
| InChI | InChI=1S/C24H22F3N3O6S/c1-23(2)21(33)29(17-5-4-15(13-28)19(12-17)24(25,26)27)22(37)30(23)16-6-8-18(9-7-16)36-35-11-3-10-34-14-20(31)32/h4-9,12H,3,10-11,14H2,1-2H3,(H,31,32) |
| InChIKey | JFVWPXSRIHLEMW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 112.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|