C16H17F3N4OS — CID 22116936
4-[3-(3-hydroxypropyl)-5-imino-4,4-dimethyl-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 22116936) has the molecular formula C16H17F3N4OS and a molecular weight of 370.40 g/mol. Its IUPAC name is 4-[3-(3-hydroxypropyl)-5-imino-4,4-dimethyl-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-(3-hydroxypropyl)-5-imino-4,4-dimethyl-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 22116936 |
| Molecular Formula | C16H17F3N4OS |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 4-[3-(3-hydroxypropyl)-5-imino-4,4-dimethyl-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | [H]/N=C1/N(c2ccc(C#N)c(C(F)(F)F)c2)C(=S)N(CCCO)C1(C)C |
| InChI | InChI=1S/C16H17F3N4OS/c1-15(2)13(21)23(14(25)22(15)6-3-7-24)11-5-4-10(9-20)12(8-11)16(17,18)19/h4-5,8,21,24H,3,6-7H2,1-2H3/b21-13+ |
| InChIKey | XZDHIGPTVXKZRU-FYJGNVAPSA-N |
| XLogP | 3.12 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|