C22H18F4N4OS — CID 163670791
4-[3-[4-(3-aminooxiran-2-yl)-3-fluorophenyl]-4,4-dimethyl-5-methylidene-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 163670791) has the molecular formula C22H18F4N4OS and a molecular weight of 462.47 g/mol. Its IUPAC name is 4-[3-[4-(3-aminooxiran-2-yl)-3-fluorophenyl]-4,4-dimethyl-5-methylidene-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-[4-(3-aminooxiran-2-yl)-3-fluorophenyl]-4,4-dimethyl-5-methylidene-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 163670791 |
| Molecular Formula | C22H18F4N4OS |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 4-[3-[4-(3-aminooxiran-2-yl)-3-fluorophenyl]-4,4-dimethyl-5-methylidene-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C=C1N(c2ccc(C#N)c(C(F)(F)F)c2)C(=S)N(c2ccc(C3OC3N)c(F)c2)C1(C)C |
| InChI | InChI=1S/C22H18F4N4OS/c1-11-21(2,3)30(14-6-7-15(17(23)9-14)18-19(28)31-18)20(32)29(11)13-5-4-12(10-27)16(8-13)22(24,25)26/h4-9,18-19H,1,28H2,2-3H3 |
| InChIKey | JCIPTHBBOZSGSL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|