C23H17F3N4O2S — CID 15952994
(E)-3-[4-[7-[4-cyano-3-(trifluoromethyl)phenyl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]phenyl]prop-2-enamide (PubChem CID 15952994) has the molecular formula C23H17F3N4O2S and a molecular weight of 470.48 g/mol. Its IUPAC name is (E)-3-[4-[7-[4-cyano-3-(trifluoromethyl)phenyl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[4-[7-[4-cyano-3-(trifluoromethyl)phenyl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 15952994 |
| Molecular Formula | C23H17F3N4O2S |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | (E)-3-[4-[7-[4-cyano-3-(trifluoromethyl)phenyl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]phenyl]prop-2-enamide |
| SMILES | N#Cc1ccc(N2C(=O)C3(CCC3)N(c3ccc(/C=C/C(N)=O)cc3)C2=S)cc1C(F)(F)F |
| InChI | InChI=1S/C23H17F3N4O2S/c24-23(25,26)18-12-17(8-5-15(18)13-27)29-20(32)22(10-1-11-22)30(21(29)33)16-6-2-14(3-7-16)4-9-19(28)31/h2-9,12H,1,10-11H2,(H2,28,31)/b9-4+ |
| InChIKey | MYVOOQGUGYHSRI-RUDMXATFSA-N |
| XLogP | 4.14 |
| TPSA | 90.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|