C23H16F3N3O3S — CID 59296632
(E)-3-[4-[7-[4-isocyano-3-(trifluoromethyl)phenyl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]phenyl]prop-2-enoic acid (PubChem CID 59296632) has the molecular formula C23H16F3N3O3S and a molecular weight of 471.46 g/mol. Its IUPAC name is (E)-3-[4-[7-[4-isocyano-3-(trifluoromethyl)phenyl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[7-[4-isocyano-3-(trifluoromethyl)phenyl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 59296632 |
| Molecular Formula | C23H16F3N3O3S |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | (E)-3-[4-[7-[4-isocyano-3-(trifluoromethyl)phenyl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]phenyl]prop-2-enoic acid |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)C3(CCC3)N(c3ccc(/C=C/C(=O)O)cc3)C2=S)cc1C(F)(F)F |
| InChI | InChI=1S/C23H16F3N3O3S/c1-27-18-9-8-16(13-17(18)23(24,25)26)28-20(32)22(11-2-12-22)29(21(28)33)15-6-3-14(4-7-15)5-10-19(30)31/h3-10,13H,2,11-12H2,(H,30,31)/b10-5+ |
| InChIKey | WLCVFOHHPZMMBU-BJMVGYQFSA-N |
| XLogP | 5.41 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|