C17H17F3N6OS — CID 59296612
1-(4-azidobutyl)-3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 59296612) has the molecular formula C17H17F3N6OS and a molecular weight of 410.43 g/mol. Its IUPAC name is 1-(4-azidobutyl)-3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 1-(4-azidobutyl)-3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 59296612 |
| Molecular Formula | C17H17F3N6OS |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 1-(4-azidobutyl)-3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)C(C)(C)N(CCCCN=[N+]=[N-])C2=S)cc1C(F)(F)F |
| InChI | InChI=1S/C17H17F3N6OS/c1-16(2)14(27)26(15(28)25(16)9-5-4-8-23-24-21)11-6-7-13(22-3)12(10-11)17(18,19)20/h6-7,10H,4-5,8-9H2,1-2H3 |
| InChIKey | GSEYUOZFUIZZRZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 76.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|