C18H14F3N5O3S2 — CID 135016783
6-[3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]pyridine-2-sulfonamide (PubChem CID 135016783) has the molecular formula C18H14F3N5O3S2 and a molecular weight of 469.47 g/mol. Its IUPAC name is 6-[3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]pyridine-2-sulfonamide.
| Compound Name | 6-[3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 135016783 |
| Molecular Formula | C18H14F3N5O3S2 |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 6-[3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]pyridine-2-sulfonamide |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)C(C)(C)N(c3cccc(S(N)(=O)=O)n3)C2=S)cc1C(F)(F)F |
| InChI | InChI=1S/C18H14F3N5O3S2/c1-17(2)15(27)25(10-7-8-12(23-3)11(9-10)18(19,20)21)16(30)26(17)13-5-4-6-14(24-13)31(22,28)29/h4-9H,1-2H3,(H2,22,28,29) |
| InChIKey | SITHHAXJWVCLDZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|