C24H23F3N4O3S — CID 59296422
N-[4-[3-[3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]propoxy]phenyl]acetamide (PubChem CID 59296422) has the molecular formula C24H23F3N4O3S and a molecular weight of 504.53 g/mol. Its IUPAC name is N-[4-[3-[3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]propoxy]phenyl]acetamide.
| Compound Name | N-[4-[3-[3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]propoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 59296422 |
| Molecular Formula | C24H23F3N4O3S |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | N-[4-[3-[3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]propoxy]phenyl]acetamide |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)C(C)(C)N(CCCOc3ccc(NC(C)=O)cc3)C2=S)cc1C(F)(F)F |
| InChI | InChI=1S/C24H23F3N4O3S/c1-15(32)29-16-6-9-18(10-7-16)34-13-5-12-30-22(35)31(21(33)23(30,2)3)17-8-11-20(28-4)19(14-17)24(25,26)27/h6-11,14H,5,12-13H2,1-3H3,(H,29,32) |
| InChIKey | KKWPZYVIVXJHGU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|