C28H31F3N4O3S — CID 59296414
3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-1-[3-[2-methyl-4-(morpholin-4-ylmethyl)phenoxy]propyl]-2-sulfanylideneimidazolidin-4-one (PubChem CID 59296414) has the molecular formula C28H31F3N4O3S and a molecular weight of 560.64 g/mol. Its IUPAC name is 3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-1-[3-[2-methyl-4-(morpholin-4-ylmethyl)phenoxy]propyl]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-1-[3-[2-methyl-4-(morpholin-4-ylmethyl)phenoxy]propyl]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 59296414 |
| Molecular Formula | C28H31F3N4O3S |
| Molecular Weight | 560.64 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | 3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-1-[3-[2-methyl-4-(morpholin-4-ylmethyl)phenoxy]propyl]-2-sulfanylideneimidazolidin-4-one |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)C(C)(C)N(CCCOc3ccc(CN4CCOCC4)cc3C)C2=S)cc1C(F)(F)F |
| InChI | InChI=1S/C28H31F3N4O3S/c1-19-16-20(18-33-11-14-37-15-12-33)6-9-24(19)38-13-5-10-34-26(39)35(25(36)27(34,2)3)21-7-8-23(32-4)22(17-21)28(29,30)31/h6-9,16-17H,5,10-15,18H2,1-3H3 |
| InChIKey | IPPDCHDCNNOXPE-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 49.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.64 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|