C27H24FN3O2S — CID 159816092
3-(3-fluoro-4-isocyanophenyl)-5,5-dimethyl-1-[3-(4-phenylphenoxy)propyl]-2-sulfanylideneimidazolidin-4-one (PubChem CID 159816092) has the molecular formula C27H24FN3O2S and a molecular weight of 473.57 g/mol. Its IUPAC name is 3-(3-fluoro-4-isocyanophenyl)-5,5-dimethyl-1-[3-(4-phenylphenoxy)propyl]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 3-(3-fluoro-4-isocyanophenyl)-5,5-dimethyl-1-[3-(4-phenylphenoxy)propyl]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 159816092 |
| Molecular Formula | C27H24FN3O2S |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 3-(3-fluoro-4-isocyanophenyl)-5,5-dimethyl-1-[3-(4-phenylphenoxy)propyl]-2-sulfanylideneimidazolidin-4-one |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)C(C)(C)N(CCCOc3ccc(-c4ccccc4)cc3)C2=S)cc1F |
| InChI | InChI=1S/C27H24FN3O2S/c1-27(2)25(32)31(21-12-15-24(29-3)23(28)18-21)26(34)30(27)16-7-17-33-22-13-10-20(11-14-22)19-8-5-4-6-9-19/h4-6,8-15,18H,7,16-17H2,1-2H3 |
| InChIKey | AKZDRYZHQJAKRU-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 37.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|