C25H24N4O2S — CID 153212619
3-(4-isocyano-3-methylphenyl)-1-(3-isoquinolin-7-yloxypropyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 153212619) has the molecular formula C25H24N4O2S and a molecular weight of 444.56 g/mol. Its IUPAC name is 3-(4-isocyano-3-methylphenyl)-1-(3-isoquinolin-7-yloxypropyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 3-(4-isocyano-3-methylphenyl)-1-(3-isoquinolin-7-yloxypropyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 153212619 |
| Molecular Formula | C25H24N4O2S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 3-(4-isocyano-3-methylphenyl)-1-(3-isoquinolin-7-yloxypropyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)C(C)(C)N(CCCOc3ccc4ccncc4c3)C2=S)cc1C |
| InChI | InChI=1S/C25H24N4O2S/c1-17-14-20(7-9-22(17)26-4)29-23(30)25(2,3)28(24(29)32)12-5-13-31-21-8-6-18-10-11-27-16-19(18)15-21/h6-11,14-16H,5,12-13H2,1-3H3 |
| InChIKey | WMCDTCFWOUTULH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 50.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|