About 7-pentoxyisoquinoline
7-pentoxyisoquinoline (PubChem CID 151702579) has the molecular formula C14H17NO
and a molecular weight of 215.30 g/mol. Its IUPAC name is 7-pentoxyisoquinoline.
Molecular Properties
| Compound Name | 7-pentoxyisoquinoline |
| PubChem CID | 151702579 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 7-pentoxyisoquinoline |
| SMILES | CCCCCOc1ccc2ccncc2c1 |
| InChI | InChI=1S/C14H17NO/c1-2-3-4-9-16-14-6-5-12-7-8-15-11-13(12)10-14/h5-8,10-11H,2-4,9H2,1H3 |
| InChIKey | REXNGURMNXLUME-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-pentoxyisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-pentoxyisoquinoline?
The IUPAC name of 7-pentoxyisoquinoline (CID 151702579) is 7-pentoxyisoquinoline.
What is the SMILES notation for 7-pentoxyisoquinoline?
The canonical SMILES for 7-pentoxyisoquinoline is CCCCCOc1ccc2ccncc2c1.
What is the InChIKey of 7-pentoxyisoquinoline?
The InChIKey is REXNGURMNXLUME-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO/c1-2-3-4-9-16-14-6-5-12-7-8-15-11-13(12)10-14/h5-8,10-11H,2-4,9H2,1H3.
What are the key properties of 7-pentoxyisoquinoline?
7-pentoxyisoquinoline has a molecular weight of 215.30 g/mol, XLogP of 3.80, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-pentoxyisoquinoline is sourced from PubChem (CID 151702579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).