C19H16N6OS — CID 147851614
1-(4-azidophenyl)-3-(4-isocyano-3-methylphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 147851614) has the molecular formula C19H16N6OS and a molecular weight of 376.45 g/mol. Its IUPAC name is 1-(4-azidophenyl)-3-(4-isocyano-3-methylphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 1-(4-azidophenyl)-3-(4-isocyano-3-methylphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 147851614 |
| Molecular Formula | C19H16N6OS |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 1-(4-azidophenyl)-3-(4-isocyano-3-methylphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)C(C)(C)N(c3ccc(N=[N+]=[N-])cc3)C2=S)cc1C |
| InChI | InChI=1S/C19H16N6OS/c1-12-11-15(9-10-16(12)21-4)24-17(26)19(2,3)25(18(24)27)14-7-5-13(6-8-14)22-23-20/h5-11H,1-3H3 |
| InChIKey | HUXVRICTZGNDGO-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 76.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|