C28H27N3O2S — CID 158224556
3-(4-isocyano-3-methylphenyl)-5,5-dimethyl-1-[4-(4-propan-2-yloxyphenyl)phenyl]-2-sulfanylideneimidazolidin-4-one (PubChem CID 158224556) has the molecular formula C28H27N3O2S and a molecular weight of 469.61 g/mol. Its IUPAC name is 3-(4-isocyano-3-methylphenyl)-5,5-dimethyl-1-[4-(4-propan-2-yloxyphenyl)phenyl]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 3-(4-isocyano-3-methylphenyl)-5,5-dimethyl-1-[4-(4-propan-2-yloxyphenyl)phenyl]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 158224556 |
| Molecular Formula | C28H27N3O2S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 3-(4-isocyano-3-methylphenyl)-5,5-dimethyl-1-[4-(4-propan-2-yloxyphenyl)phenyl]-2-sulfanylideneimidazolidin-4-one |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)C(C)(C)N(c3ccc(-c4ccc(OC(C)C)cc4)cc3)C2=S)cc1C |
| InChI | InChI=1S/C28H27N3O2S/c1-18(2)33-24-14-9-21(10-15-24)20-7-11-22(12-8-20)31-27(34)30(26(32)28(31,4)5)23-13-16-25(29-6)19(3)17-23/h7-18H,1-5H3 |
| InChIKey | JYFBEHSQYAEXGO-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 37.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|