C18H13ClFN3O2S — CID 123297433
3-(3-chloro-4-isocyanophenyl)-1-(3-fluoro-4-hydroxyphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 123297433) has the molecular formula C18H13ClFN3O2S and a molecular weight of 389.84 g/mol. Its IUPAC name is 3-(3-chloro-4-isocyanophenyl)-1-(3-fluoro-4-hydroxyphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 3-(3-chloro-4-isocyanophenyl)-1-(3-fluoro-4-hydroxyphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 123297433 |
| Molecular Formula | C18H13ClFN3O2S |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 3-(3-chloro-4-isocyanophenyl)-1-(3-fluoro-4-hydroxyphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)C(C)(C)N(c3ccc(O)c(F)c3)C2=S)cc1Cl |
| InChI | InChI=1S/C18H13ClFN3O2S/c1-18(2)16(25)22(10-4-6-14(21-3)12(19)8-10)17(26)23(18)11-5-7-15(24)13(20)9-11/h4-9,24H,1-2H3 |
| InChIKey | IYGDKUPJTCNENP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|