C23H22FN3O4S — CID 157362757
1-[3-fluoro-4-[(3R)-4-hydroxyoxolan-3-yl]oxyphenyl]-3-(4-isocyano-3-methylphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 157362757) has the molecular formula C23H22FN3O4S and a molecular weight of 455.51 g/mol. Its IUPAC name is 1-[3-fluoro-4-[(3R)-4-hydroxyoxolan-3-yl]oxyphenyl]-3-(4-isocyano-3-methylphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 1-[3-fluoro-4-[(3R)-4-hydroxyoxolan-3-yl]oxyphenyl]-3-(4-isocyano-3-methylphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 157362757 |
| Molecular Formula | C23H22FN3O4S |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 1-[3-fluoro-4-[(3R)-4-hydroxyoxolan-3-yl]oxyphenyl]-3-(4-isocyano-3-methylphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)C(C)(C)N(c3ccc(O[C@@H]4COCC4O)c(F)c3)C2=S)cc1C |
| InChI | InChI=1S/C23H22FN3O4S/c1-13-9-14(5-7-17(13)25-4)26-21(29)23(2,3)27(22(26)32)15-6-8-19(16(24)10-15)31-20-12-30-11-18(20)28/h5-10,18,20,28H,11-12H2,1-3H3/t18?,20-/m1/s1 |
| InChIKey | FGNXCNZFPLWJMZ-ROPPNANJSA-N |
| XLogP | 3.74 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|