C25H26FN3O4S — CID 157370264
1-[4-[(2,2-dimethyl-1,3-dioxan-5-yl)oxy]-3-fluorophenyl]-3-(4-isocyano-3-methylphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 157370264) has the molecular formula C25H26FN3O4S and a molecular weight of 483.57 g/mol. Its IUPAC name is 1-[4-[(2,2-dimethyl-1,3-dioxan-5-yl)oxy]-3-fluorophenyl]-3-(4-isocyano-3-methylphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 1-[4-[(2,2-dimethyl-1,3-dioxan-5-yl)oxy]-3-fluorophenyl]-3-(4-isocyano-3-methylphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 157370264 |
| Molecular Formula | C25H26FN3O4S |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 1-[4-[(2,2-dimethyl-1,3-dioxan-5-yl)oxy]-3-fluorophenyl]-3-(4-isocyano-3-methylphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)C(C)(C)N(c3ccc(OC4COC(C)(C)OC4)c(F)c3)C2=S)cc1C |
| InChI | InChI=1S/C25H26FN3O4S/c1-15-11-16(7-9-20(15)27-6)28-22(30)24(2,3)29(23(28)34)17-8-10-21(19(26)12-17)33-18-13-31-25(4,5)32-14-18/h7-12,18H,13-14H2,1-5H3 |
| InChIKey | BJRGZZQVNHFTTG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 55.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|