C24H20FN5O3S — CID 158526452
N-[[2-fluoro-4-[3-(4-isocyano-3-methylphenyl)-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]phenyl]methyl]-1,3-oxazole-5-carboxamide (PubChem CID 158526452) has the molecular formula C24H20FN5O3S and a molecular weight of 477.52 g/mol. Its IUPAC name is N-[[2-fluoro-4-[3-(4-isocyano-3-methylphenyl)-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]phenyl]methyl]-1,3-oxazole-5-carboxamide.
| Compound Name | N-[[2-fluoro-4-[3-(4-isocyano-3-methylphenyl)-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]phenyl]methyl]-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 158526452 |
| Molecular Formula | C24H20FN5O3S |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | N-[[2-fluoro-4-[3-(4-isocyano-3-methylphenyl)-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]phenyl]methyl]-1,3-oxazole-5-carboxamide |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)C(C)(C)N(c3ccc(CNC(=O)c4cnco4)c(F)c3)C2=S)cc1C |
| InChI | InChI=1S/C24H20FN5O3S/c1-14-9-16(7-8-19(14)26-4)29-22(32)24(2,3)30(23(29)34)17-6-5-15(18(25)10-17)11-28-21(31)20-12-27-13-33-20/h5-10,12-13H,11H2,1-3H3,(H,28,31) |
| InChIKey | HMVOUCNOUSZZKK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|