C25H25F3N6OS — CID 59004596
1-[4-(6-azidohexyl)phenyl]-3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 59004596) has the molecular formula C25H25F3N6OS and a molecular weight of 514.58 g/mol. Its IUPAC name is 1-[4-(6-azidohexyl)phenyl]-3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 1-[4-(6-azidohexyl)phenyl]-3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 59004596 |
| Molecular Formula | C25H25F3N6OS |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | 1-[4-(6-azidohexyl)phenyl]-3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)C(C)(C)N(c3ccc(CCCCCCN=[N+]=[N-])cc3)C2=S)cc1C(F)(F)F |
| InChI | InChI=1S/C25H25F3N6OS/c1-24(2)22(35)33(19-13-14-21(30-3)20(16-19)25(26,27)28)23(36)34(24)18-11-9-17(10-12-18)8-6-4-5-7-15-31-32-29/h9-14,16H,4-8,15H2,1-2H3 |
| InChIKey | DELZJXAICFMZDE-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 76.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|