C25H23F3N4O3S — CID 59296548
N-(2-hydroxyethyl)-3-[4-[7-[4-isocyano-3-(trifluoromethyl)phenyl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]phenyl]propanamide (PubChem CID 59296548) has the molecular formula C25H23F3N4O3S and a molecular weight of 516.55 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-3-[4-[7-[4-isocyano-3-(trifluoromethyl)phenyl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]phenyl]propanamide.
| Compound Name | N-(2-hydroxyethyl)-3-[4-[7-[4-isocyano-3-(trifluoromethyl)phenyl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 59296548 |
| Molecular Formula | C25H23F3N4O3S |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | N-(2-hydroxyethyl)-3-[4-[7-[4-isocyano-3-(trifluoromethyl)phenyl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]phenyl]propanamide |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)C3(CCC3)N(c3ccc(CCC(=O)NCCO)cc3)C2=S)cc1C(F)(F)F |
| InChI | InChI=1S/C25H23F3N4O3S/c1-29-20-9-8-18(15-19(20)25(26,27)28)31-22(35)24(11-2-12-24)32(23(31)36)17-6-3-16(4-7-17)5-10-21(34)30-13-14-33/h3-4,6-9,15,33H,2,5,10-14H2,(H,30,34) |
| InChIKey | IEZDZJQPFUYXHO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|