C24H21F3N4O2S — CID 15951523
4-[4-[7-[4-cyano-3-(trifluoromethyl)phenyl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]phenyl]butanamide (PubChem CID 15951523) has the molecular formula C24H21F3N4O2S and a molecular weight of 486.52 g/mol. Its IUPAC name is 4-[4-[7-[4-cyano-3-(trifluoromethyl)phenyl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]phenyl]butanamide.
| Compound Name | 4-[4-[7-[4-cyano-3-(trifluoromethyl)phenyl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]phenyl]butanamide |
|---|---|
| PubChem CID | 15951523 |
| Molecular Formula | C24H21F3N4O2S |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 4-[4-[7-[4-cyano-3-(trifluoromethyl)phenyl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]phenyl]butanamide |
| SMILES | N#Cc1ccc(N2C(=O)C3(CCC3)N(c3ccc(CCCC(N)=O)cc3)C2=S)cc1C(F)(F)F |
| InChI | InChI=1S/C24H21F3N4O2S/c25-24(26,27)19-13-18(10-7-16(19)14-28)30-21(33)23(11-2-12-23)31(22(30)34)17-8-5-15(6-9-17)3-1-4-20(29)32/h5-10,13H,1-4,11-12H2,(H2,29,32) |
| InChIKey | ZTGWHYPKAWWLCS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 90.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|