C18H12F3N3OS — CID 59296554
3-[4-isocyano-3-(trifluoromethyl)phenyl]-1-(4-methylphenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 59296554) has the molecular formula C18H12F3N3OS and a molecular weight of 375.38 g/mol. Its IUPAC name is 3-[4-isocyano-3-(trifluoromethyl)phenyl]-1-(4-methylphenyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 3-[4-isocyano-3-(trifluoromethyl)phenyl]-1-(4-methylphenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 59296554 |
| Molecular Formula | C18H12F3N3OS |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 3-[4-isocyano-3-(trifluoromethyl)phenyl]-1-(4-methylphenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)CN(c3ccc(C)cc3)C2=S)cc1C(F)(F)F |
| InChI | InChI=1S/C18H12F3N3OS/c1-11-3-5-12(6-4-11)23-10-16(25)24(17(23)26)13-7-8-15(22-2)14(9-13)18(19,20)21/h3-9H,10H2,1H3 |
| InChIKey | MALJUIVCDOHHJV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 27.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|