C18H13F3N2O4 — CID 59799953
2-[4-isocyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-6,7a-dihydro-3aH-4,7-epoxyisoindole-1,3,5-trione (PubChem CID 59799953) has the molecular formula C18H13F3N2O4 and a molecular weight of 378.31 g/mol. Its IUPAC name is 2-[4-isocyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-6,7a-dihydro-3aH-4,7-epoxyisoindole-1,3,5-trione.
| Compound Name | 2-[4-isocyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-6,7a-dihydro-3aH-4,7-epoxyisoindole-1,3,5-trione |
|---|---|
| PubChem CID | 59799953 |
| Molecular Formula | C18H13F3N2O4 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 2-[4-isocyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-6,7a-dihydro-3aH-4,7-epoxyisoindole-1,3,5-trione |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)C3C(C2=O)C2(C)OC3(C)CC2=O)cc1C(F)(F)F |
| InChI | InChI=1S/C18H13F3N2O4/c1-16-7-11(24)17(2,27-16)13-12(16)14(25)23(15(13)26)8-4-5-10(22-3)9(6-8)18(19,20)21/h4-6,12-13H,7H2,1-2H3 |
| InChIKey | MTJDBDFXZHFBRF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 68.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|